C14H16N6 — CID 62244092
[3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]quinolin-2-yl]hydrazine (PubChem CID 62244092) has the molecular formula C14H16N6 and a molecular weight of 268.32 g/mol. Its IUPAC name is [3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]quinolin-2-yl]hydrazine.
| Compound Name | [3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]quinolin-2-yl]hydrazine |
|---|---|
| PubChem CID | 62244092 |
| Molecular Formula | C14H16N6 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | [3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]quinolin-2-yl]hydrazine |
| SMILES | Cc1nc(C)n(Cc2cc3ccccc3nc2NN)n1 |
| InChI | InChI=1S/C14H16N6/c1-9-16-10(2)20(19-9)8-12-7-11-5-3-4-6-13(11)17-14(12)18-15/h3-7H,8,15H2,1-2H3,(H,17,18) |
| InChIKey | BKXKEAZKWRLUQH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|