C12H16N4OS — CID 62245263
[4-[(2,3,5-trimethylphenoxy)methyl]thiadiazol-5-yl]hydrazine (PubChem CID 62245263) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is [4-[(2,3,5-trimethylphenoxy)methyl]thiadiazol-5-yl]hydrazine.
| Compound Name | [4-[(2,3,5-trimethylphenoxy)methyl]thiadiazol-5-yl]hydrazine |
|---|---|
| PubChem CID | 62245263 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | [4-[(2,3,5-trimethylphenoxy)methyl]thiadiazol-5-yl]hydrazine |
| SMILES | Cc1cc(C)c(C)c(OCc2nnsc2NN)c1 |
| InChI | InChI=1S/C12H16N4OS/c1-7-4-8(2)9(3)11(5-7)17-6-10-12(14-13)18-16-15-10/h4-5,14H,6,13H2,1-3H3 |
| InChIKey | YSYOPRHMJQTQBR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|