C13H19N5OS — CID 62245346
[2-[(3,3-dimethylmorpholin-4-yl)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 62245346) has the molecular formula C13H19N5OS and a molecular weight of 293.40 g/mol. Its IUPAC name is [2-[(3,3-dimethylmorpholin-4-yl)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-[(3,3-dimethylmorpholin-4-yl)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62245346 |
| Molecular Formula | C13H19N5OS |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | [2-[(3,3-dimethylmorpholin-4-yl)methyl]thieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | CC1(C)COCCN1Cc1nc(NN)c2ccsc2n1 |
| InChI | InChI=1S/C13H19N5OS/c1-13(2)8-19-5-4-18(13)7-10-15-11(17-14)9-3-6-20-12(9)16-10/h3,6H,4-5,7-8,14H2,1-2H3,(H,15,16,17) |
| InChIKey | RHYZTZBNSWTDEH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|