C14H24N4O3 — CID 62247011
N-[(4-hydrazinyl-3-nitrophenyl)methyl]-N-(2-methoxyethyl)-2-methylpropan-1-amine (PubChem CID 62247011) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-[(4-hydrazinyl-3-nitrophenyl)methyl]-N-(2-methoxyethyl)-2-methylpropan-1-amine.
| Compound Name | N-[(4-hydrazinyl-3-nitrophenyl)methyl]-N-(2-methoxyethyl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 62247011 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | N-[(4-hydrazinyl-3-nitrophenyl)methyl]-N-(2-methoxyethyl)-2-methylpropan-1-amine |
| SMILES | COCCN(Cc1ccc(NN)c([N+](=O)[O-])c1)CC(C)C |
| InChI | InChI=1S/C14H24N4O3/c1-11(2)9-17(6-7-21-3)10-12-4-5-13(16-15)14(8-12)18(19)20/h4-5,8,11,16H,6-7,9-10,15H2,1-3H3 |
| InChIKey | QALORHBWCOWBSL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 93.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|