C10H11N5O2 — CID 62247564
2-hydrazinyl-N-(5-methyl-1,2-oxazol-3-yl)pyridine-4-carboxamide (PubChem CID 62247564) has the molecular formula C10H11N5O2 and a molecular weight of 233.23 g/mol. Its IUPAC name is 2-hydrazinyl-N-(5-methyl-1,2-oxazol-3-yl)pyridine-4-carboxamide.
| Compound Name | 2-hydrazinyl-N-(5-methyl-1,2-oxazol-3-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62247564 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 2-hydrazinyl-N-(5-methyl-1,2-oxazol-3-yl)pyridine-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccnc(NN)c2)no1 |
| InChI | InChI=1S/C10H11N5O2/c1-6-4-9(15-17-6)13-10(16)7-2-3-12-8(5-7)14-11/h2-5H,11H2,1H3,(H,12,14)(H,13,15,16) |
| InChIKey | KFOFOMWSCHWGKH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|