C13H14FN5O — CID 62247886
N-[1-(3-fluorophenyl)ethyl]-6-hydrazinylpyridazine-3-carboxamide (PubChem CID 62247886) has the molecular formula C13H14FN5O and a molecular weight of 275.29 g/mol. Its IUPAC name is N-[1-(3-fluorophenyl)ethyl]-6-hydrazinylpyridazine-3-carboxamide.
| Compound Name | N-[1-(3-fluorophenyl)ethyl]-6-hydrazinylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 62247886 |
| Molecular Formula | C13H14FN5O |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-[1-(3-fluorophenyl)ethyl]-6-hydrazinylpyridazine-3-carboxamide |
| SMILES | CC(NC(=O)c1ccc(NN)nn1)c1cccc(F)c1 |
| InChI | InChI=1S/C13H14FN5O/c1-8(9-3-2-4-10(14)7-9)16-13(20)11-5-6-12(17-15)19-18-11/h2-8H,15H2,1H3,(H,16,20)(H,17,19) |
| InChIKey | OFKSWNZZJLAING-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|