C10H11BrN6O2 — CID 62248272
5-bromo-2-hydrazinyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridine-3-carboxamide (PubChem CID 62248272) has the molecular formula C10H11BrN6O2 and a molecular weight of 327.14 g/mol. Its IUPAC name is 5-bromo-2-hydrazinyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-hydrazinyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62248272 |
| Molecular Formula | C10H11BrN6O2 |
| Molecular Weight | 327.14 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 5-bromo-2-hydrazinyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridine-3-carboxamide |
| SMILES | Cc1noc(CNC(=O)c2cc(Br)cnc2NN)n1 |
| InChI | InChI=1S/C10H11BrN6O2/c1-5-15-8(19-17-5)4-14-10(18)7-2-6(11)3-13-9(7)16-12/h2-3H,4,12H2,1H3,(H,13,16)(H,14,18) |
| InChIKey | MFMMARSYXFDQGU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.14 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|