C13H10ClN5O — CID 62248864
5-chloro-N-(4-cyanophenyl)-6-hydrazinylpyridine-3-carboxamide (PubChem CID 62248864) has the molecular formula C13H10ClN5O and a molecular weight of 287.71 g/mol. Its IUPAC name is 5-chloro-N-(4-cyanophenyl)-6-hydrazinylpyridine-3-carboxamide.
| Compound Name | 5-chloro-N-(4-cyanophenyl)-6-hydrazinylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 62248864 |
| Molecular Formula | C13H10ClN5O |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 5-chloro-N-(4-cyanophenyl)-6-hydrazinylpyridine-3-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)c2cnc(NN)c(Cl)c2)cc1 |
| InChI | InChI=1S/C13H10ClN5O/c14-11-5-9(7-17-12(11)19-16)13(20)18-10-3-1-8(6-15)2-4-10/h1-5,7H,16H2,(H,17,19)(H,18,20) |
| InChIKey | DCTUXQSBIBHCIM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|