C11H15N5O4 — CID 62249335
5-hydrazinyl-N-[1-(methylamino)-1-oxopropan-2-yl]-2-nitrobenzamide (PubChem CID 62249335) has the molecular formula C11H15N5O4 and a molecular weight of 281.27 g/mol. Its IUPAC name is 5-hydrazinyl-N-[1-(methylamino)-1-oxopropan-2-yl]-2-nitrobenzamide.
| Compound Name | 5-hydrazinyl-N-[1-(methylamino)-1-oxopropan-2-yl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 62249335 |
| Molecular Formula | C11H15N5O4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 5-hydrazinyl-N-[1-(methylamino)-1-oxopropan-2-yl]-2-nitrobenzamide |
| SMILES | CNC(=O)C(C)NC(=O)c1cc(NN)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15N5O4/c1-6(10(17)13-2)14-11(18)8-5-7(15-12)3-4-9(8)16(19)20/h3-6,15H,12H2,1-2H3,(H,13,17)(H,14,18) |
| InChIKey | XAEUSWKKGZTDQD-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|