C13H15N3O2 — CID 62249792
N-[2-(furan-2-yl)ethyl]-2-hydrazinylbenzamide (PubChem CID 62249792) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-2-hydrazinylbenzamide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-2-hydrazinylbenzamide |
|---|---|
| PubChem CID | 62249792 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-2-hydrazinylbenzamide |
| SMILES | NNc1ccccc1C(=O)NCCc1ccco1 |
| InChI | InChI=1S/C13H15N3O2/c14-16-12-6-2-1-5-11(12)13(17)15-8-7-10-4-3-9-18-10/h1-6,9,16H,7-8,14H2,(H,15,17) |
| InChIKey | IEWOLFSJZAFAKL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|