C13H17N3 — CID 62250072
(3-ethyl-2,8-dimethylquinolin-4-yl)hydrazine (PubChem CID 62250072) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is (3-ethyl-2,8-dimethylquinolin-4-yl)hydrazine.
| Compound Name | (3-ethyl-2,8-dimethylquinolin-4-yl)hydrazine |
|---|---|
| PubChem CID | 62250072 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | (3-ethyl-2,8-dimethylquinolin-4-yl)hydrazine |
| SMILES | CCc1c(C)nc2c(C)cccc2c1NN |
| InChI | InChI=1S/C13H17N3/c1-4-10-9(3)15-12-8(2)6-5-7-11(12)13(10)16-14/h5-7H,4,14H2,1-3H3,(H,15,16) |
| InChIKey | ANVXLLPPUWJKAU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|