C13H13BrFN3 — CID 62250572
(8-bromo-5-fluoro-1,2,3,4-tetrahydroacridin-9-yl)hydrazine (PubChem CID 62250572) has the molecular formula C13H13BrFN3 and a molecular weight of 310.17 g/mol. Its IUPAC name is (8-bromo-5-fluoro-1,2,3,4-tetrahydroacridin-9-yl)hydrazine.
| Compound Name | (8-bromo-5-fluoro-1,2,3,4-tetrahydroacridin-9-yl)hydrazine |
|---|---|
| PubChem CID | 62250572 |
| Molecular Formula | C13H13BrFN3 |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | (8-bromo-5-fluoro-1,2,3,4-tetrahydroacridin-9-yl)hydrazine |
| SMILES | NNc1c2c(nc3c(F)ccc(Br)c13)CCCC2 |
| InChI | InChI=1S/C13H13BrFN3/c14-8-5-6-9(15)13-11(8)12(18-16)7-3-1-2-4-10(7)17-13/h5-6H,1-4,16H2,(H,17,18) |
| InChIKey | VSIZGKQDGCTJGK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|