About [6-tert-butyl-2-(4,5-dibromofuran-2-yl)pyrimidin-4-yl]hydrazine
[6-tert-butyl-2-(4,5-dibromofuran-2-yl)pyrimidin-4-yl]hydrazine (PubChem CID 62251107) has the molecular formula C12H14Br2N4O
and a molecular weight of 390.08 g/mol. Its IUPAC name is [6-tert-butyl-2-(4,5-dibromofuran-2-yl)pyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [6-tert-butyl-2-(4,5-dibromofuran-2-yl)pyrimidin-4-yl]hydrazine |
| PubChem CID | 62251107 |
| Molecular Formula | C12H14Br2N4O |
| Molecular Weight | 390.08 g/mol |
| Exact Mass | 387.95 |
| IUPAC Name | [6-tert-butyl-2-(4,5-dibromofuran-2-yl)pyrimidin-4-yl]hydrazine |
| SMILES | CC(C)(C)c1cc(NN)nc(-c2cc(Br)c(Br)o2)n1 |
| InChI | InChI=1S/C12H14Br2N4O/c1-12(2,3)8-5-9(18-15)17-11(16-8)7-4-6(13)10(14)19-7/h4-5H,15H2,1-3H3,(H,16,17,18) |
| InChIKey | NPCVWNADZPTMCJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.08 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [6-tert-butyl-2-(4,5-dibromofuran-2-yl)pyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-tert-butyl-2-(4,5-dibromofuran-2-yl)pyrimidin-4-yl]hydrazine?
The IUPAC name of [6-tert-butyl-2-(4,5-dibromofuran-2-yl)pyrimidin-4-yl]hydrazine (CID 62251107) is [6-tert-butyl-2-(4,5-dibromofuran-2-yl)pyrimidin-4-yl]hydrazine.
What is the SMILES notation for [6-tert-butyl-2-(4,5-dibromofuran-2-yl)pyrimidin-4-yl]hydrazine?
The canonical SMILES for [6-tert-butyl-2-(4,5-dibromofuran-2-yl)pyrimidin-4-yl]hydrazine is CC(C)(C)c1cc(NN)nc(-c2cc(Br)c(Br)o2)n1.
What is the InChIKey of [6-tert-butyl-2-(4,5-dibromofuran-2-yl)pyrimidin-4-yl]hydrazine?
The InChIKey is NPCVWNADZPTMCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Br2N4O/c1-12(2,3)8-5-9(18-15)17-11(16-8)7-4-6(13)10(14)19-7/h4-5H,15H2,1-3H3,(H,16,17,18).
What are the key properties of [6-tert-butyl-2-(4,5-dibromofuran-2-yl)pyrimidin-4-yl]hydrazine?
[6-tert-butyl-2-(4,5-dibromofuran-2-yl)pyrimidin-4-yl]hydrazine has a molecular weight of 390.08 g/mol, XLogP of 3.84, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-tert-butyl-2-(4,5-dibromofuran-2-yl)pyrimidin-4-yl]hydrazine is sourced from PubChem (CID 62251107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).