About [2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]pyrimidin-4-yl]hydrazine
[2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]pyrimidin-4-yl]hydrazine (PubChem CID 62251261) has the molecular formula C17H24N4
and a molecular weight of 284.41 g/mol. Its IUPAC name is [2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]pyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]pyrimidin-4-yl]hydrazine |
| PubChem CID | 62251261 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | [2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]pyrimidin-4-yl]hydrazine |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1Cc1nccc(NN)n1 |
| InChI | InChI=1S/C17H24N4/c1-11-8-13(17(3,4)5)9-12(2)14(11)10-16-19-7-6-15(20-16)21-18/h6-9H,10,18H2,1-5H3,(H,19,20,21) |
| InChIKey | YZZKUNDYBQYCCW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]pyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]pyrimidin-4-yl]hydrazine?
The IUPAC name of [2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]pyrimidin-4-yl]hydrazine (CID 62251261) is [2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]pyrimidin-4-yl]hydrazine.
What is the SMILES notation for [2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]pyrimidin-4-yl]hydrazine?
The canonical SMILES for [2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]pyrimidin-4-yl]hydrazine is Cc1cc(C(C)(C)C)cc(C)c1Cc1nccc(NN)n1.
What is the InChIKey of [2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]pyrimidin-4-yl]hydrazine?
The InChIKey is YZZKUNDYBQYCCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4/c1-11-8-13(17(3,4)5)9-12(2)14(11)10-16-19-7-6-15(20-16)21-18/h6-9H,10,18H2,1-5H3,(H,19,20,21).
What are the key properties of [2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]pyrimidin-4-yl]hydrazine?
[2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]pyrimidin-4-yl]hydrazine has a molecular weight of 284.41 g/mol, XLogP of 3.27, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]pyrimidin-4-yl]hydrazine is sourced from PubChem (CID 62251261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).