About [7,8-difluoro-2-(trifluoromethyl)quinolin-4-yl]hydrazine
[7,8-difluoro-2-(trifluoromethyl)quinolin-4-yl]hydrazine (PubChem CID 62251548) has the molecular formula C10H6F5N3
and a molecular weight of 263.17 g/mol. Its IUPAC name is [7,8-difluoro-2-(trifluoromethyl)quinolin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [7,8-difluoro-2-(trifluoromethyl)quinolin-4-yl]hydrazine |
| PubChem CID | 62251548 |
| Molecular Formula | C10H6F5N3 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | [7,8-difluoro-2-(trifluoromethyl)quinolin-4-yl]hydrazine |
| SMILES | NNc1cc(C(F)(F)F)nc2c(F)c(F)ccc12 |
| InChI | InChI=1S/C10H6F5N3/c11-5-2-1-4-6(18-16)3-7(10(13,14)15)17-9(4)8(5)12/h1-3H,16H2,(H,17,18) |
| InChIKey | VSPKAQWGVXBJNT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [7,8-difluoro-2-(trifluoromethyl)quinolin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7,8-difluoro-2-(trifluoromethyl)quinolin-4-yl]hydrazine?
The IUPAC name of [7,8-difluoro-2-(trifluoromethyl)quinolin-4-yl]hydrazine (CID 62251548) is [7,8-difluoro-2-(trifluoromethyl)quinolin-4-yl]hydrazine.
What is the SMILES notation for [7,8-difluoro-2-(trifluoromethyl)quinolin-4-yl]hydrazine?
The canonical SMILES for [7,8-difluoro-2-(trifluoromethyl)quinolin-4-yl]hydrazine is NNc1cc(C(F)(F)F)nc2c(F)c(F)ccc12.
What is the InChIKey of [7,8-difluoro-2-(trifluoromethyl)quinolin-4-yl]hydrazine?
The InChIKey is VSPKAQWGVXBJNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F5N3/c11-5-2-1-4-6(18-16)3-7(10(13,14)15)17-9(4)8(5)12/h1-3H,16H2,(H,17,18).
What are the key properties of [7,8-difluoro-2-(trifluoromethyl)quinolin-4-yl]hydrazine?
[7,8-difluoro-2-(trifluoromethyl)quinolin-4-yl]hydrazine has a molecular weight of 263.17 g/mol, XLogP of 2.82, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [7,8-difluoro-2-(trifluoromethyl)quinolin-4-yl]hydrazine is sourced from PubChem (CID 62251548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).