C9H11F3N4 — CID 62251599
[2-(2,2,2-trifluoroethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine (PubChem CID 62251599) has the molecular formula C9H11F3N4 and a molecular weight of 232.21 g/mol. Its IUPAC name is [2-(2,2,2-trifluoroethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(2,2,2-trifluoroethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62251599 |
| Molecular Formula | C9H11F3N4 |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | [2-(2,2,2-trifluoroethyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(CC(F)(F)F)nc2c1CCC2 |
| InChI | InChI=1S/C9H11F3N4/c10-9(11,12)4-7-14-6-3-1-2-5(6)8(15-7)16-13/h1-4,13H2,(H,14,15,16) |
| InChIKey | TUXQUVRQXDFGIR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|