About [6-propan-2-yl-2-(2,4,6-trimethylphenyl)pyrimidin-4-yl]hydrazine
[6-propan-2-yl-2-(2,4,6-trimethylphenyl)pyrimidin-4-yl]hydrazine (PubChem CID 62251863) has the molecular formula C16H22N4
and a molecular weight of 270.38 g/mol. Its IUPAC name is [6-propan-2-yl-2-(2,4,6-trimethylphenyl)pyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [6-propan-2-yl-2-(2,4,6-trimethylphenyl)pyrimidin-4-yl]hydrazine |
| PubChem CID | 62251863 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | [6-propan-2-yl-2-(2,4,6-trimethylphenyl)pyrimidin-4-yl]hydrazine |
| SMILES | Cc1cc(C)c(-c2nc(NN)cc(C(C)C)n2)c(C)c1 |
| InChI | InChI=1S/C16H22N4/c1-9(2)13-8-14(20-17)19-16(18-13)15-11(4)6-10(3)7-12(15)5/h6-9H,17H2,1-5H3,(H,18,19,20) |
| InChIKey | FRTFLAWWJZAMTD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [6-propan-2-yl-2-(2,4,6-trimethylphenyl)pyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-propan-2-yl-2-(2,4,6-trimethylphenyl)pyrimidin-4-yl]hydrazine?
The IUPAC name of [6-propan-2-yl-2-(2,4,6-trimethylphenyl)pyrimidin-4-yl]hydrazine (CID 62251863) is [6-propan-2-yl-2-(2,4,6-trimethylphenyl)pyrimidin-4-yl]hydrazine.
What is the SMILES notation for [6-propan-2-yl-2-(2,4,6-trimethylphenyl)pyrimidin-4-yl]hydrazine?
The canonical SMILES for [6-propan-2-yl-2-(2,4,6-trimethylphenyl)pyrimidin-4-yl]hydrazine is Cc1cc(C)c(-c2nc(NN)cc(C(C)C)n2)c(C)c1.
What is the InChIKey of [6-propan-2-yl-2-(2,4,6-trimethylphenyl)pyrimidin-4-yl]hydrazine?
The InChIKey is FRTFLAWWJZAMTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4/c1-9(2)13-8-14(20-17)19-16(18-13)15-11(4)6-10(3)7-12(15)5/h6-9H,17H2,1-5H3,(H,18,19,20).
What are the key properties of [6-propan-2-yl-2-(2,4,6-trimethylphenyl)pyrimidin-4-yl]hydrazine?
[6-propan-2-yl-2-(2,4,6-trimethylphenyl)pyrimidin-4-yl]hydrazine has a molecular weight of 270.38 g/mol, XLogP of 3.48, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-propan-2-yl-2-(2,4,6-trimethylphenyl)pyrimidin-4-yl]hydrazine is sourced from PubChem (CID 62251863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).