C15H20N4O2 — CID 62252600
[2-(2,3-dimethoxyphenyl)-6-propylpyrimidin-4-yl]hydrazine (PubChem CID 62252600) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is [2-(2,3-dimethoxyphenyl)-6-propylpyrimidin-4-yl]hydrazine.
| Compound Name | [2-(2,3-dimethoxyphenyl)-6-propylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62252600 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | [2-(2,3-dimethoxyphenyl)-6-propylpyrimidin-4-yl]hydrazine |
| SMILES | CCCc1cc(NN)nc(-c2cccc(OC)c2OC)n1 |
| InChI | InChI=1S/C15H20N4O2/c1-4-6-10-9-13(19-16)18-15(17-10)11-7-5-8-12(20-2)14(11)21-3/h5,7-9H,4,6,16H2,1-3H3,(H,17,18,19) |
| InChIKey | VRHCBVQLHAUAAQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|