6-(1,2,4-triazol-1-yl)pyridine-2-carboxylic acid

C8H6N4O2 — CID 62253542

IUPAC6-(1,2,4-triazol-1-yl)pyridine-2-carboxylic acid
SMILESO=C(O)c1cccc(-n2cncn2)n1
InChIInChI=1S/C8H6N4O2/c13-8(14)6-2-1-3-7(11-6)12-5-9-4-10-12/h1-5H,(H,13,14)
InChIKeyUVPSZGAYEKCLOP-UHFFFAOYSA-N
MW190.16 g/mol
LogP0.36
Rot. Bonds2

About 6-(1,2,4-triazol-1-yl)pyridine-2-carboxylic acid

6-(1,2,4-triazol-1-yl)pyridine-2-carboxylic acid (PubChem CID 62253542) has the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. Its IUPAC name is 6-(1,2,4-triazol-1-yl)pyridine-2-carboxylic acid.

Molecular Properties

Compound Name6-(1,2,4-triazol-1-yl)pyridine-2-carboxylic acid
PubChem CID62253542
Molecular FormulaC8H6N4O2
Molecular Weight190.16 g/mol
Exact Mass190.05
IUPAC Name6-(1,2,4-triazol-1-yl)pyridine-2-carboxylic acid
SMILESO=C(O)c1cccc(-n2cncn2)n1
InChIInChI=1S/C8H6N4O2/c13-8(14)6-2-1-3-7(11-6)12-5-9-4-10-12/h1-5H,(H,13,14)
InChIKeyUVPSZGAYEKCLOP-UHFFFAOYSA-N
XLogP0.36
TPSA80.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.16
LogP ≤ 50.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 6-(1,2,4-triazol-1-yl)pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(1,2,4-triazol-1-yl)pyridine-2-carboxylic acid?
The IUPAC name of 6-(1,2,4-triazol-1-yl)pyridine-2-carboxylic acid (CID 62253542) is 6-(1,2,4-triazol-1-yl)pyridine-2-carboxylic acid.
What is the SMILES notation for 6-(1,2,4-triazol-1-yl)pyridine-2-carboxylic acid?
The canonical SMILES for 6-(1,2,4-triazol-1-yl)pyridine-2-carboxylic acid is O=C(O)c1cccc(-n2cncn2)n1.
What is the InChIKey of 6-(1,2,4-triazol-1-yl)pyridine-2-carboxylic acid?
The InChIKey is UVPSZGAYEKCLOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4O2/c13-8(14)6-2-1-3-7(11-6)12-5-9-4-10-12/h1-5H,(H,13,14).
What are the key properties of 6-(1,2,4-triazol-1-yl)pyridine-2-carboxylic acid?
6-(1,2,4-triazol-1-yl)pyridine-2-carboxylic acid has a molecular weight of 190.16 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,2,4-triazol-1-yl)pyridine-2-carboxylic acid is sourced from PubChem (CID 62253542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).