C10H10BFN2O3S — CID 62254033
[5-fluoro-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]phenyl]boronic acid (PubChem CID 62254033) has the molecular formula C10H10BFN2O3S and a molecular weight of 268.08 g/mol. Its IUPAC name is [5-fluoro-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]phenyl]boronic acid.
| Compound Name | [5-fluoro-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 62254033 |
| Molecular Formula | C10H10BFN2O3S |
| Molecular Weight | 268.08 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | [5-fluoro-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]phenyl]boronic acid |
| SMILES | Cc1nnc(SCc2ccc(F)cc2B(O)O)o1 |
| InChI | InChI=1S/C10H10BFN2O3S/c1-6-13-14-10(17-6)18-5-7-2-3-8(12)4-9(7)11(15)16/h2-4,15-16H,5H2,1H3 |
| InChIKey | DJIUAAYPBAQLIK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.08 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|