About 4-[6-(chloromethyl)-2-pyridinyl]-3,3-dimethylmorpholine
4-[6-(chloromethyl)-2-pyridinyl]-3,3-dimethylmorpholine (PubChem CID 62254126) has the molecular formula C12H17ClN2O
and a molecular weight of 240.73 g/mol. Its IUPAC name is 4-[6-(chloromethyl)-2-pyridinyl]-3,3-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-[6-(chloromethyl)-2-pyridinyl]-3,3-dimethylmorpholine |
| PubChem CID | 62254126 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-[6-(chloromethyl)-2-pyridinyl]-3,3-dimethylmorpholine |
| SMILES | CC1(C)COCCN1c1cccc(CCl)n1 |
| InChI | InChI=1S/C12H17ClN2O/c1-12(2)9-16-7-6-15(12)11-5-3-4-10(8-13)14-11/h3-5H,6-9H2,1-2H3 |
| InChIKey | HGBPGJQCTPKYEV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[6-(chloromethyl)-2-pyridinyl]-3,3-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(chloromethyl)-2-pyridinyl]-3,3-dimethylmorpholine?
The IUPAC name of 4-[6-(chloromethyl)-2-pyridinyl]-3,3-dimethylmorpholine (CID 62254126) is 4-[6-(chloromethyl)-2-pyridinyl]-3,3-dimethylmorpholine.
What is the SMILES notation for 4-[6-(chloromethyl)-2-pyridinyl]-3,3-dimethylmorpholine?
The canonical SMILES for 4-[6-(chloromethyl)-2-pyridinyl]-3,3-dimethylmorpholine is CC1(C)COCCN1c1cccc(CCl)n1.
What is the InChIKey of 4-[6-(chloromethyl)-2-pyridinyl]-3,3-dimethylmorpholine?
The InChIKey is HGBPGJQCTPKYEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClN2O/c1-12(2)9-16-7-6-15(12)11-5-3-4-10(8-13)14-11/h3-5H,6-9H2,1-2H3.
What are the key properties of 4-[6-(chloromethyl)-2-pyridinyl]-3,3-dimethylmorpholine?
4-[6-(chloromethyl)-2-pyridinyl]-3,3-dimethylmorpholine has a molecular weight of 240.73 g/mol, XLogP of 2.44, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(chloromethyl)-2-pyridinyl]-3,3-dimethylmorpholine is sourced from PubChem (CID 62254126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).