6-[(5-methyl-1,3-thiazol-2-yl)amino]pyridine-2-carboxylic acid

C10H9N3O2S — CID 62254475

IUPAC6-[(5-methyl-1,3-thiazol-2-yl)amino]pyridine-2-carboxylic acid
SMILESCc1cnc(Nc2cccc(C(=O)O)n2)s1
InChIInChI=1S/C10H9N3O2S/c1-6-5-11-10(16-6)13-8-4-2-3-7(12-8)9(14)15/h2-5H,1H3,(H,14,15)(H,11,12,13)
InChIKeyGEUBHCXKGCVHOI-UHFFFAOYSA-N
MW235.27 g/mol
LogP2.29
Rot. Bonds3

About 6-[(5-methyl-1,3-thiazol-2-yl)amino]pyridine-2-carboxylic acid

6-[(5-methyl-1,3-thiazol-2-yl)amino]pyridine-2-carboxylic acid (PubChem CID 62254475) has the molecular formula C10H9N3O2S and a molecular weight of 235.27 g/mol. Its IUPAC name is 6-[(5-methyl-1,3-thiazol-2-yl)amino]pyridine-2-carboxylic acid.

Molecular Properties

Compound Name6-[(5-methyl-1,3-thiazol-2-yl)amino]pyridine-2-carboxylic acid
PubChem CID62254475
Molecular FormulaC10H9N3O2S
Molecular Weight235.27 g/mol
Exact Mass235.04
IUPAC Name6-[(5-methyl-1,3-thiazol-2-yl)amino]pyridine-2-carboxylic acid
SMILESCc1cnc(Nc2cccc(C(=O)O)n2)s1
InChIInChI=1S/C10H9N3O2S/c1-6-5-11-10(16-6)13-8-4-2-3-7(12-8)9(14)15/h2-5H,1H3,(H,14,15)(H,11,12,13)
InChIKeyGEUBHCXKGCVHOI-UHFFFAOYSA-N
XLogP2.29
TPSA75.11 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.27
LogP ≤ 52.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 6-[(5-methyl-1,3-thiazol-2-yl)amino]pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-[(5-methyl-1,3-thiazol-2-yl)amino]pyridine-2-carboxylic acid?
The IUPAC name of 6-[(5-methyl-1,3-thiazol-2-yl)amino]pyridine-2-carboxylic acid (CID 62254475) is 6-[(5-methyl-1,3-thiazol-2-yl)amino]pyridine-2-carboxylic acid.
What is the SMILES notation for 6-[(5-methyl-1,3-thiazol-2-yl)amino]pyridine-2-carboxylic acid?
The canonical SMILES for 6-[(5-methyl-1,3-thiazol-2-yl)amino]pyridine-2-carboxylic acid is Cc1cnc(Nc2cccc(C(=O)O)n2)s1.
What is the InChIKey of 6-[(5-methyl-1,3-thiazol-2-yl)amino]pyridine-2-carboxylic acid?
The InChIKey is GEUBHCXKGCVHOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2S/c1-6-5-11-10(16-6)13-8-4-2-3-7(12-8)9(14)15/h2-5H,1H3,(H,14,15)(H,11,12,13).
What are the key properties of 6-[(5-methyl-1,3-thiazol-2-yl)amino]pyridine-2-carboxylic acid?
6-[(5-methyl-1,3-thiazol-2-yl)amino]pyridine-2-carboxylic acid has a molecular weight of 235.27 g/mol, XLogP of 2.29, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(5-methyl-1,3-thiazol-2-yl)amino]pyridine-2-carboxylic acid is sourced from PubChem (CID 62254475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).