About 4-[4-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]but-3-yn-1-ol
4-[4-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]but-3-yn-1-ol (PubChem CID 62255450) has the molecular formula C15H16N2O3S
and a molecular weight of 304.37 g/mol. Its IUPAC name is 4-[4-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]but-3-yn-1-ol.
Molecular Properties
| Compound Name | 4-[4-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]but-3-yn-1-ol |
| PubChem CID | 62255450 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 4-[4-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]but-3-yn-1-ol |
| SMILES | Cc1nnc(SCCOc2ccc(C#CCCO)cc2)o1 |
| InChI | InChI=1S/C15H16N2O3S/c1-12-16-17-15(20-12)21-11-10-19-14-7-5-13(6-8-14)4-2-3-9-18/h5-8,18H,3,9-11H2,1H3 |
| InChIKey | XASVJTXCSHDYMZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]but-3-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]but-3-yn-1-ol?
The IUPAC name of 4-[4-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]but-3-yn-1-ol (CID 62255450) is 4-[4-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]but-3-yn-1-ol.
What is the SMILES notation for 4-[4-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]but-3-yn-1-ol?
The canonical SMILES for 4-[4-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]but-3-yn-1-ol is Cc1nnc(SCCOc2ccc(C#CCCO)cc2)o1.
What is the InChIKey of 4-[4-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]but-3-yn-1-ol?
The InChIKey is XASVJTXCSHDYMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O3S/c1-12-16-17-15(20-12)21-11-10-19-14-7-5-13(6-8-14)4-2-3-9-18/h5-8,18H,3,9-11H2,1H3.
What are the key properties of 4-[4-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]but-3-yn-1-ol?
4-[4-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]but-3-yn-1-ol has a molecular weight of 304.37 g/mol, XLogP of 2.28, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]but-3-yn-1-ol is sourced from PubChem (CID 62255450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).