C13H28N2O2 — CID 62255853
2-[2-hydroxyethyl-[[1-(methylaminomethyl)cyclohexyl]methyl]amino]ethanol (PubChem CID 62255853) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-[2-hydroxyethyl-[[1-(methylaminomethyl)cyclohexyl]methyl]amino]ethanol.
| Compound Name | 2-[2-hydroxyethyl-[[1-(methylaminomethyl)cyclohexyl]methyl]amino]ethanol |
|---|---|
| PubChem CID | 62255853 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 2-[2-hydroxyethyl-[[1-(methylaminomethyl)cyclohexyl]methyl]amino]ethanol |
| SMILES | CNCC1(CN(CCO)CCO)CCCCC1 |
| InChI | InChI=1S/C13H28N2O2/c1-14-11-13(5-3-2-4-6-13)12-15(7-9-16)8-10-17/h14,16-17H,2-12H2,1H3 |
| InChIKey | SGCBOBLKTOHIET-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |