About N-[[3-(aminomethyl)oxolan-3-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine
N-[[3-(aminomethyl)oxolan-3-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine (PubChem CID 62256035) has the molecular formula C10H19F3N2O
and a molecular weight of 240.27 g/mol. Its IUPAC name is N-[[3-(aminomethyl)oxolan-3-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine.
Molecular Properties
| Compound Name | N-[[3-(aminomethyl)oxolan-3-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine |
| PubChem CID | 62256035 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N-[[3-(aminomethyl)oxolan-3-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine |
| SMILES | CCN(CC(F)(F)F)CC1(CN)CCOC1 |
| InChI | InChI=1S/C10H19F3N2O/c1-2-15(7-10(11,12)13)6-9(5-14)3-4-16-8-9/h2-8,14H2,1H3 |
| InChIKey | LJALZZYBCLYFJX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[3-(aminomethyl)oxolan-3-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-(aminomethyl)oxolan-3-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine?
The IUPAC name of N-[[3-(aminomethyl)oxolan-3-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine (CID 62256035) is N-[[3-(aminomethyl)oxolan-3-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine.
What is the SMILES notation for N-[[3-(aminomethyl)oxolan-3-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine?
The canonical SMILES for N-[[3-(aminomethyl)oxolan-3-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine is CCN(CC(F)(F)F)CC1(CN)CCOC1.
What is the InChIKey of N-[[3-(aminomethyl)oxolan-3-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine?
The InChIKey is LJALZZYBCLYFJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N2O/c1-2-15(7-10(11,12)13)6-9(5-14)3-4-16-8-9/h2-8,14H2,1H3.
What are the key properties of N-[[3-(aminomethyl)oxolan-3-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine?
N-[[3-(aminomethyl)oxolan-3-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine has a molecular weight of 240.27 g/mol, XLogP of 1.24, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-(aminomethyl)oxolan-3-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine is sourced from PubChem (CID 62256035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).