C17H18N2O2 — CID 622563
1,2,2,3-tetramethylperimidine-6,7-dicarbaldehyde (PubChem CID 622563) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1,2,2,3-tetramethylperimidine-6,7-dicarbaldehyde.
| Compound Name | 1,2,2,3-tetramethylperimidine-6,7-dicarbaldehyde |
|---|---|
| PubChem CID | 622563 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 1,2,2,3-tetramethylperimidine-6,7-dicarbaldehyde |
| SMILES | CN1c2ccc(C=O)c3c(C=O)ccc(c23)N(C)C1(C)C |
| InChI | InChI=1S/C17H18N2O2/c1-17(2)18(3)13-7-5-11(9-20)15-12(10-21)6-8-14(16(13)15)19(17)4/h5-10H,1-4H3 |
| InChIKey | AOOHZDHSYHNXKM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|