C15H29F3N2 — CID 62256736
N-cyclopropyl-2,2-diethyl-N'-propyl-N-(2,2,2-trifluoroethyl)propane-1,3-diamine (PubChem CID 62256736) has the molecular formula C15H29F3N2 and a molecular weight of 294.41 g/mol. Its IUPAC name is N-cyclopropyl-2,2-diethyl-N'-propyl-N-(2,2,2-trifluoroethyl)propane-1,3-diamine.
| Compound Name | N-cyclopropyl-2,2-diethyl-N'-propyl-N-(2,2,2-trifluoroethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 62256736 |
| Molecular Formula | C15H29F3N2 |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | N-cyclopropyl-2,2-diethyl-N'-propyl-N-(2,2,2-trifluoroethyl)propane-1,3-diamine |
| SMILES | CCCNCC(CC)(CC)CN(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C15H29F3N2/c1-4-9-19-10-14(5-2,6-3)11-20(13-7-8-13)12-15(16,17)18/h13,19H,4-12H2,1-3H3 |
| InChIKey | FUVIVUULAXUCPW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|