About N-[2-(dimethylamino)ethyl]-N'-ethyl-2-methyl-N-(2-methylpropyl)-2-propylpropane-1,3-diamine
N-[2-(dimethylamino)ethyl]-N'-ethyl-2-methyl-N-(2-methylpropyl)-2-propylpropane-1,3-diamine (PubChem CID 62257607) has the molecular formula C17H39N3
and a molecular weight of 285.52 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N'-ethyl-2-methyl-N-(2-methylpropyl)-2-propylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-[2-(dimethylamino)ethyl]-N'-ethyl-2-methyl-N-(2-methylpropyl)-2-propylpropane-1,3-diamine |
| PubChem CID | 62257607 |
| Molecular Formula | C17H39N3 |
| Molecular Weight | 285.52 g/mol |
| Exact Mass | 285.31 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N'-ethyl-2-methyl-N-(2-methylpropyl)-2-propylpropane-1,3-diamine |
| SMILES | CCCC(C)(CNCC)CN(CCN(C)C)CC(C)C |
| InChI | InChI=1S/C17H39N3/c1-8-10-17(5,14-18-9-2)15-20(13-16(3)4)12-11-19(6)7/h16,18H,8-15H2,1-7H3 |
| InChIKey | JKIGUWMDDJYYCZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(dimethylamino)ethyl]-N'-ethyl-2-methyl-N-(2-methylpropyl)-2-propylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(dimethylamino)ethyl]-N'-ethyl-2-methyl-N-(2-methylpropyl)-2-propylpropane-1,3-diamine?
The IUPAC name of N-[2-(dimethylamino)ethyl]-N'-ethyl-2-methyl-N-(2-methylpropyl)-2-propylpropane-1,3-diamine (CID 62257607) is N-[2-(dimethylamino)ethyl]-N'-ethyl-2-methyl-N-(2-methylpropyl)-2-propylpropane-1,3-diamine.
What is the SMILES notation for N-[2-(dimethylamino)ethyl]-N'-ethyl-2-methyl-N-(2-methylpropyl)-2-propylpropane-1,3-diamine?
The canonical SMILES for N-[2-(dimethylamino)ethyl]-N'-ethyl-2-methyl-N-(2-methylpropyl)-2-propylpropane-1,3-diamine is CCCC(C)(CNCC)CN(CCN(C)C)CC(C)C.
What is the InChIKey of N-[2-(dimethylamino)ethyl]-N'-ethyl-2-methyl-N-(2-methylpropyl)-2-propylpropane-1,3-diamine?
The InChIKey is JKIGUWMDDJYYCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H39N3/c1-8-10-17(5,14-18-9-2)15-20(13-16(3)4)12-11-19(6)7/h16,18H,8-15H2,1-7H3.
What are the key properties of N-[2-(dimethylamino)ethyl]-N'-ethyl-2-methyl-N-(2-methylpropyl)-2-propylpropane-1,3-diamine?
N-[2-(dimethylamino)ethyl]-N'-ethyl-2-methyl-N-(2-methylpropyl)-2-propylpropane-1,3-diamine has a molecular weight of 285.52 g/mol, XLogP of 2.92, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(dimethylamino)ethyl]-N'-ethyl-2-methyl-N-(2-methylpropyl)-2-propylpropane-1,3-diamine is sourced from PubChem (CID 62257607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).