C16H34N2 — CID 62257887
N-methyl-N-[[1-[(propan-2-ylamino)methyl]cyclopentyl]methyl]pentan-2-amine (PubChem CID 62257887) has the molecular formula C16H34N2 and a molecular weight of 254.46 g/mol. Its IUPAC name is N-methyl-N-[[1-[(propan-2-ylamino)methyl]cyclopentyl]methyl]pentan-2-amine.
| Compound Name | N-methyl-N-[[1-[(propan-2-ylamino)methyl]cyclopentyl]methyl]pentan-2-amine |
|---|---|
| PubChem CID | 62257887 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | N-methyl-N-[[1-[(propan-2-ylamino)methyl]cyclopentyl]methyl]pentan-2-amine |
| SMILES | CCCC(C)N(C)CC1(CNC(C)C)CCCC1 |
| InChI | InChI=1S/C16H34N2/c1-6-9-15(4)18(5)13-16(10-7-8-11-16)12-17-14(2)3/h14-15,17H,6-13H2,1-5H3 |
| InChIKey | JUOILEJIFFINKK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |