C18H39N3 — CID 62258867
2-[[4-[(dimethylamino)methyl]piperidin-1-yl]methyl]-2-ethyl-N-propan-2-ylbutan-1-amine (PubChem CID 62258867) has the molecular formula C18H39N3 and a molecular weight of 297.53 g/mol. Its IUPAC name is 2-[[4-[(dimethylamino)methyl]piperidin-1-yl]methyl]-2-ethyl-N-propan-2-ylbutan-1-amine.
| Compound Name | 2-[[4-[(dimethylamino)methyl]piperidin-1-yl]methyl]-2-ethyl-N-propan-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 62258867 |
| Molecular Formula | C18H39N3 |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.31 |
| IUPAC Name | 2-[[4-[(dimethylamino)methyl]piperidin-1-yl]methyl]-2-ethyl-N-propan-2-ylbutan-1-amine |
| SMILES | CCC(CC)(CNC(C)C)CN1CCC(CN(C)C)CC1 |
| InChI | InChI=1S/C18H39N3/c1-7-18(8-2,14-19-16(3)4)15-21-11-9-17(10-12-21)13-20(5)6/h16-17,19H,7-15H2,1-6H3 |
| InChIKey | CQQJVJWQZVUXRY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |