About 2-[(3,3-dimethylmorpholin-4-yl)methyl]-N,2-dimethylbutan-1-amine
2-[(3,3-dimethylmorpholin-4-yl)methyl]-N,2-dimethylbutan-1-amine (PubChem CID 62259652) has the molecular formula C13H28N2O
and a molecular weight of 228.38 g/mol. Its IUPAC name is 2-[(3,3-dimethylmorpholin-4-yl)methyl]-N,2-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 2-[(3,3-dimethylmorpholin-4-yl)methyl]-N,2-dimethylbutan-1-amine |
| PubChem CID | 62259652 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 2-[(3,3-dimethylmorpholin-4-yl)methyl]-N,2-dimethylbutan-1-amine |
| SMILES | CCC(C)(CNC)CN1CCOCC1(C)C |
| InChI | InChI=1S/C13H28N2O/c1-6-13(4,9-14-5)10-15-7-8-16-11-12(15,2)3/h14H,6-11H2,1-5H3 |
| InChIKey | UTELFCAPUPWRJK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3,3-dimethylmorpholin-4-yl)methyl]-N,2-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,3-dimethylmorpholin-4-yl)methyl]-N,2-dimethylbutan-1-amine?
The IUPAC name of 2-[(3,3-dimethylmorpholin-4-yl)methyl]-N,2-dimethylbutan-1-amine (CID 62259652) is 2-[(3,3-dimethylmorpholin-4-yl)methyl]-N,2-dimethylbutan-1-amine.
What is the SMILES notation for 2-[(3,3-dimethylmorpholin-4-yl)methyl]-N,2-dimethylbutan-1-amine?
The canonical SMILES for 2-[(3,3-dimethylmorpholin-4-yl)methyl]-N,2-dimethylbutan-1-amine is CCC(C)(CNC)CN1CCOCC1(C)C.
What is the InChIKey of 2-[(3,3-dimethylmorpholin-4-yl)methyl]-N,2-dimethylbutan-1-amine?
The InChIKey is UTELFCAPUPWRJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O/c1-6-13(4,9-14-5)10-15-7-8-16-11-12(15,2)3/h14H,6-11H2,1-5H3.
What are the key properties of 2-[(3,3-dimethylmorpholin-4-yl)methyl]-N,2-dimethylbutan-1-amine?
2-[(3,3-dimethylmorpholin-4-yl)methyl]-N,2-dimethylbutan-1-amine has a molecular weight of 228.38 g/mol, XLogP of 1.73, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,3-dimethylmorpholin-4-yl)methyl]-N,2-dimethylbutan-1-amine is sourced from PubChem (CID 62259652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).