About 2,5-bis(4-bromophenyl)-1,4-dithiine
2,5-bis(4-bromophenyl)-1,4-dithiine (PubChem CID 622597) has the molecular formula C16H10Br2S2
and a molecular weight of 426.20 g/mol. Its IUPAC name is 2,5-bis(4-bromophenyl)-1,4-dithiine.
Molecular Properties
| Compound Name | 2,5-bis(4-bromophenyl)-1,4-dithiine |
| PubChem CID | 622597 |
| Molecular Formula | C16H10Br2S2 |
| Molecular Weight | 426.20 g/mol |
| Exact Mass | 423.86 |
| IUPAC Name | 2,5-bis(4-bromophenyl)-1,4-dithiine |
| SMILES | Brc1ccc(C2=CSC(c3ccc(Br)cc3)=CS2)cc1 |
| InChI | InChI=1S/C16H10Br2S2/c17-13-5-1-11(2-6-13)15-9-20-16(10-19-15)12-3-7-14(18)8-4-12/h1-10H |
| InChIKey | DQZPVMUGBCYFCA-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.20 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-bis(4-bromophenyl)-1,4-dithiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(4-bromophenyl)-1,4-dithiine?
The IUPAC name of 2,5-bis(4-bromophenyl)-1,4-dithiine (CID 622597) is 2,5-bis(4-bromophenyl)-1,4-dithiine.
What is the SMILES notation for 2,5-bis(4-bromophenyl)-1,4-dithiine?
The canonical SMILES for 2,5-bis(4-bromophenyl)-1,4-dithiine is Brc1ccc(C2=CSC(c3ccc(Br)cc3)=CS2)cc1.
What is the InChIKey of 2,5-bis(4-bromophenyl)-1,4-dithiine?
The InChIKey is DQZPVMUGBCYFCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Br2S2/c17-13-5-1-11(2-6-13)15-9-20-16(10-19-15)12-3-7-14(18)8-4-12/h1-10H.
What are the key properties of 2,5-bis(4-bromophenyl)-1,4-dithiine?
2,5-bis(4-bromophenyl)-1,4-dithiine has a molecular weight of 426.20 g/mol, XLogP of 6.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(4-bromophenyl)-1,4-dithiine is sourced from PubChem (CID 622597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).