C17H19N3O4 — CID 622602
1-[6-hydroxy-3,6-dimethyl-4-(3-nitrophenyl)-2,4,5,7-tetrahydroindazol-5-yl]ethanone (PubChem CID 622602) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 1-[6-hydroxy-3,6-dimethyl-4-(3-nitrophenyl)-2,4,5,7-tetrahydroindazol-5-yl]ethanone.
| Compound Name | 1-[6-hydroxy-3,6-dimethyl-4-(3-nitrophenyl)-2,4,5,7-tetrahydroindazol-5-yl]ethanone |
|---|---|
| PubChem CID | 622602 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1-[6-hydroxy-3,6-dimethyl-4-(3-nitrophenyl)-2,4,5,7-tetrahydroindazol-5-yl]ethanone |
| SMILES | CC(=O)C1C(c2cccc([N+](=O)[O-])c2)c2c(n[nH]c2C)CC1(C)O |
| InChI | InChI=1S/C17H19N3O4/c1-9-14-13(19-18-9)8-17(3,22)16(10(2)21)15(14)11-5-4-6-12(7-11)20(23)24/h4-7,15-16,22H,8H2,1-3H3,(H,18,19) |
| InChIKey | WQMILBNFFUVBET-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 109.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|