About N-cyclopropyl-2-ethyl-N'-(2-methoxyphenyl)-N',2-dimethylpropane-1,3-diamine
N-cyclopropyl-2-ethyl-N'-(2-methoxyphenyl)-N',2-dimethylpropane-1,3-diamine (PubChem CID 62260608) has the molecular formula C17H28N2O
and a molecular weight of 276.42 g/mol. Its IUPAC name is N-cyclopropyl-2-ethyl-N'-(2-methoxyphenyl)-N',2-dimethylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-cyclopropyl-2-ethyl-N'-(2-methoxyphenyl)-N',2-dimethylpropane-1,3-diamine |
| PubChem CID | 62260608 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | N-cyclopropyl-2-ethyl-N'-(2-methoxyphenyl)-N',2-dimethylpropane-1,3-diamine |
| SMILES | CCC(C)(CNC1CC1)CN(C)c1ccccc1OC |
| InChI | InChI=1S/C17H28N2O/c1-5-17(2,12-18-14-10-11-14)13-19(3)15-8-6-7-9-16(15)20-4/h6-9,14,18H,5,10-13H2,1-4H3 |
| InChIKey | DLMQNPAATBASCB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopropyl-2-ethyl-N'-(2-methoxyphenyl)-N',2-dimethylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-2-ethyl-N'-(2-methoxyphenyl)-N',2-dimethylpropane-1,3-diamine?
The IUPAC name of N-cyclopropyl-2-ethyl-N'-(2-methoxyphenyl)-N',2-dimethylpropane-1,3-diamine (CID 62260608) is N-cyclopropyl-2-ethyl-N'-(2-methoxyphenyl)-N',2-dimethylpropane-1,3-diamine.
What is the SMILES notation for N-cyclopropyl-2-ethyl-N'-(2-methoxyphenyl)-N',2-dimethylpropane-1,3-diamine?
The canonical SMILES for N-cyclopropyl-2-ethyl-N'-(2-methoxyphenyl)-N',2-dimethylpropane-1,3-diamine is CCC(C)(CNC1CC1)CN(C)c1ccccc1OC.
What is the InChIKey of N-cyclopropyl-2-ethyl-N'-(2-methoxyphenyl)-N',2-dimethylpropane-1,3-diamine?
The InChIKey is DLMQNPAATBASCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O/c1-5-17(2,12-18-14-10-11-14)13-19(3)15-8-6-7-9-16(15)20-4/h6-9,14,18H,5,10-13H2,1-4H3.
What are the key properties of N-cyclopropyl-2-ethyl-N'-(2-methoxyphenyl)-N',2-dimethylpropane-1,3-diamine?
N-cyclopropyl-2-ethyl-N'-(2-methoxyphenyl)-N',2-dimethylpropane-1,3-diamine has a molecular weight of 276.42 g/mol, XLogP of 3.30, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-2-ethyl-N'-(2-methoxyphenyl)-N',2-dimethylpropane-1,3-diamine is sourced from PubChem (CID 62260608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).