C28H21N5O3 — CID 6226102
(Z)-N-[(11,12-diphenyl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methoxy]-1-(2-methoxyphenyl)methanimine (PubChem CID 6226102) has the molecular formula C28H21N5O3 and a molecular weight of 475.51 g/mol. Its IUPAC name is (Z)-N-[(11,12-diphenyl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methoxy]-1-(2-methoxyphenyl)methanimine.
| Compound Name | (Z)-N-[(11,12-diphenyl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methoxy]-1-(2-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 6226102 |
| Molecular Formula | C28H21N5O3 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | (Z)-N-[(11,12-diphenyl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)methoxy]-1-(2-methoxyphenyl)methanimine |
| SMILES | COc1ccccc1/C=N\OCc1nc2c3c(-c4ccccc4)c(-c4ccccc4)oc3ncn2n1 |
| InChI | InChI=1S/C28H21N5O3/c1-34-22-15-9-8-14-21(22)16-30-35-17-23-31-27-25-24(19-10-4-2-5-11-19)26(20-12-6-3-7-13-20)36-28(25)29-18-33(27)32-23/h2-16,18H,17H2,1H3/b30-16- |
| InChIKey | UJFYTDDGPRBHJC-UHBFCERESA-N |
| XLogP | 5.76 |
| TPSA | 87.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|