C17H32N2 — CID 62264243
N-[[1-[[bis(prop-2-enyl)amino]methyl]cyclopentyl]methyl]-2-methylpropan-2-amine (PubChem CID 62264243) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is N-[[1-[[bis(prop-2-enyl)amino]methyl]cyclopentyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-[[bis(prop-2-enyl)amino]methyl]cyclopentyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 62264243 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | N-[[1-[[bis(prop-2-enyl)amino]methyl]cyclopentyl]methyl]-2-methylpropan-2-amine |
| SMILES | C=CCN(CC=C)CC1(CNC(C)(C)C)CCCC1 |
| InChI | InChI=1S/C17H32N2/c1-6-12-19(13-7-2)15-17(10-8-9-11-17)14-18-16(3,4)5/h6-7,18H,1-2,8-15H2,3-5H3 |
| InChIKey | PETQCBIMIAGTBE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|