C22H23FN2O4 — CID 6226567
1-[3-(dimethylamino)propyl]-2-(2-fluorophenyl)-3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-2H-pyrrol-5-one (PubChem CID 6226567) has the molecular formula C22H23FN2O4 and a molecular weight of 398.43 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-2-(2-fluorophenyl)-3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-2H-pyrrol-5-one.
| Compound Name | 1-[3-(dimethylamino)propyl]-2-(2-fluorophenyl)-3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 6226567 |
| Molecular Formula | C22H23FN2O4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-2-(2-fluorophenyl)-3-[(E)-3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-2H-pyrrol-5-one |
| SMILES | CN(C)CCCN1C(=O)C(O)=C(C(=O)/C=C/c2ccco2)C1c1ccccc1F |
| InChI | InChI=1S/C22H23FN2O4/c1-24(2)12-6-13-25-20(16-8-3-4-9-17(16)23)19(21(27)22(25)28)18(26)11-10-15-7-5-14-29-15/h3-5,7-11,14,20,27H,6,12-13H2,1-2H3/b11-10+ |
| InChIKey | MIBAUGDMBZMRAG-ZHACJKMWSA-N |
| XLogP | 3.35 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|