C16H18ClNO2 — CID 62267931
1-(3-aminophenyl)-2-(4-chloro-3,5-dimethylphenoxy)ethanol (PubChem CID 62267931) has the molecular formula C16H18ClNO2 and a molecular weight of 291.78 g/mol. Its IUPAC name is 1-(3-aminophenyl)-2-(4-chloro-3,5-dimethylphenoxy)ethanol.
| Compound Name | 1-(3-aminophenyl)-2-(4-chloro-3,5-dimethylphenoxy)ethanol |
|---|---|
| PubChem CID | 62267931 |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 1-(3-aminophenyl)-2-(4-chloro-3,5-dimethylphenoxy)ethanol |
| SMILES | Cc1cc(OCC(O)c2cccc(N)c2)cc(C)c1Cl |
| InChI | InChI=1S/C16H18ClNO2/c1-10-6-14(7-11(2)16(10)17)20-9-15(19)12-4-3-5-13(18)8-12/h3-8,15,19H,9,18H2,1-2H3 |
| InChIKey | IUTHTSIGMWYEFK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|