C12H20N4OS — CID 62268407
2-methyl-3-(4-methylpyrimidin-2-yl)sulfanyl-2-(propan-2-ylamino)propanamide (PubChem CID 62268407) has the molecular formula C12H20N4OS and a molecular weight of 268.39 g/mol. Its IUPAC name is 2-methyl-3-(4-methylpyrimidin-2-yl)sulfanyl-2-(propan-2-ylamino)propanamide.
| Compound Name | 2-methyl-3-(4-methylpyrimidin-2-yl)sulfanyl-2-(propan-2-ylamino)propanamide |
|---|---|
| PubChem CID | 62268407 |
| Molecular Formula | C12H20N4OS |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-methyl-3-(4-methylpyrimidin-2-yl)sulfanyl-2-(propan-2-ylamino)propanamide |
| SMILES | Cc1ccnc(SCC(C)(NC(C)C)C(N)=O)n1 |
| InChI | InChI=1S/C12H20N4OS/c1-8(2)16-12(4,10(13)17)7-18-11-14-6-5-9(3)15-11/h5-6,8,16H,7H2,1-4H3,(H2,13,17) |
| InChIKey | CVXYTMDYIWVJGN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |