C20H12O — CID 622697
12-oxapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene (PubChem CID 622697) has the molecular formula C20H12O and a molecular weight of 268.31 g/mol. Its IUPAC name is 12-oxapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene.
| Compound Name | 12-oxapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene |
|---|---|
| PubChem CID | 622697 |
| Molecular Formula | C20H12O |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 12-oxapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene |
| SMILES | c1ccc2c(c1)ccc1c2oc2ccc3ccccc3c21 |
| InChI | InChI=1S/C20H12O/c1-3-7-15-13(5-1)10-12-18-19(15)17-11-9-14-6-2-4-8-16(14)20(17)21-18/h1-12H |
| InChIKey | MNXYJVWXMUBENA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |