C11H12N2O4S — CID 622705
5,6,7-trimethoxy-1,3-benzothiazole-2-carboxamide (PubChem CID 622705) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 5,6,7-trimethoxy-1,3-benzothiazole-2-carboxamide.
| Compound Name | 5,6,7-trimethoxy-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 622705 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 5,6,7-trimethoxy-1,3-benzothiazole-2-carboxamide |
| SMILES | COc1cc2nc(C(N)=O)sc2c(OC)c1OC |
| InChI | InChI=1S/C11H12N2O4S/c1-15-6-4-5-9(8(17-3)7(6)16-2)18-11(13-5)10(12)14/h4H,1-3H3,(H2,12,14) |
| InChIKey | FLSIOBSXJGHETK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |