About 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-2-ethylbutanoic acid
2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-2-ethylbutanoic acid (PubChem CID 62270845) has the molecular formula C12H23NO4S
and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-2-ethylbutanoic acid.
Molecular Properties
| Compound Name | 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-2-ethylbutanoic acid |
| PubChem CID | 62270845 |
| Molecular Formula | C12H23NO4S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(CN(C)C1CCS(=O)(=O)C1)C(=O)O |
| InChI | InChI=1S/C12H23NO4S/c1-4-12(5-2,11(14)15)9-13(3)10-6-7-18(16,17)8-10/h10H,4-9H2,1-3H3,(H,14,15) |
| InChIKey | LBUCEYPGEJDHIG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-2-ethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-2-ethylbutanoic acid?
The IUPAC name of 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-2-ethylbutanoic acid (CID 62270845) is 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-2-ethylbutanoic acid.
What is the SMILES notation for 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-2-ethylbutanoic acid?
The canonical SMILES for 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-2-ethylbutanoic acid is CCC(CC)(CN(C)C1CCS(=O)(=O)C1)C(=O)O.
What is the InChIKey of 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-2-ethylbutanoic acid?
The InChIKey is LBUCEYPGEJDHIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO4S/c1-4-12(5-2,11(14)15)9-13(3)10-6-7-18(16,17)8-10/h10H,4-9H2,1-3H3,(H,14,15).
What are the key properties of 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-2-ethylbutanoic acid?
2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-2-ethylbutanoic acid has a molecular weight of 277.39 g/mol, XLogP of 1.00, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-2-ethylbutanoic acid is sourced from PubChem (CID 62270845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).