C13H27NO2 — CID 62271230
2,2-dimethyl-3-[pentyl(propan-2-yl)amino]propanoic acid (PubChem CID 62271230) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 2,2-dimethyl-3-[pentyl(propan-2-yl)amino]propanoic acid.
| Compound Name | 2,2-dimethyl-3-[pentyl(propan-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 62271230 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 2,2-dimethyl-3-[pentyl(propan-2-yl)amino]propanoic acid |
| SMILES | CCCCCN(CC(C)(C)C(=O)O)C(C)C |
| InChI | InChI=1S/C13H27NO2/c1-6-7-8-9-14(11(2)3)10-13(4,5)12(15)16/h11H,6-10H2,1-5H3,(H,15,16) |
| InChIKey | HLLFNUNQJLOLPF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|