C11H19NO3 — CID 62271543
3-[(2-methylpyrrolidin-1-yl)methyl]oxolane-3-carboxylic acid (PubChem CID 62271543) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-[(2-methylpyrrolidin-1-yl)methyl]oxolane-3-carboxylic acid.
| Compound Name | 3-[(2-methylpyrrolidin-1-yl)methyl]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 62271543 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 3-[(2-methylpyrrolidin-1-yl)methyl]oxolane-3-carboxylic acid |
| SMILES | CC1CCCN1CC1(C(=O)O)CCOC1 |
| InChI | InChI=1S/C11H19NO3/c1-9-3-2-5-12(9)7-11(10(13)14)4-6-15-8-11/h9H,2-8H2,1H3,(H,13,14) |
| InChIKey | OLPCUJJVLLEDAA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |