C11H21NO3 — CID 62272293
2-methyl-2-[(2-methylmorpholin-4-yl)methyl]butanoic acid (PubChem CID 62272293) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 2-methyl-2-[(2-methylmorpholin-4-yl)methyl]butanoic acid.
| Compound Name | 2-methyl-2-[(2-methylmorpholin-4-yl)methyl]butanoic acid |
|---|---|
| PubChem CID | 62272293 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 2-methyl-2-[(2-methylmorpholin-4-yl)methyl]butanoic acid |
| SMILES | CCC(C)(CN1CCOC(C)C1)C(=O)O |
| InChI | InChI=1S/C11H21NO3/c1-4-11(3,10(13)14)8-12-5-6-15-9(2)7-12/h9H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | OKSQDKZGAUGCCU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |