3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethylpropanoic acid

C9H17NO4S — CID 62272681

IUPAC3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethylpropanoic acid
SMILESCC(C)(CN1CCS(=O)(=O)CC1)C(=O)O
InChIInChI=1S/C9H17NO4S/c1-9(2,8(11)12)7-10-3-5-15(13,14)6-4-10/h3-7H2,1-2H3,(H,11,12)
InChIKeyQVRFSZLIECWBFW-UHFFFAOYSA-N
MW235.30 g/mol
LogP-0.17
Rot. Bonds3

About 3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethylpropanoic acid

3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethylpropanoic acid (PubChem CID 62272681) has the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. Its IUPAC name is 3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethylpropanoic acid
PubChem CID62272681
Molecular FormulaC9H17NO4S
Molecular Weight235.30 g/mol
Exact Mass235.09
IUPAC Name3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethylpropanoic acid
SMILESCC(C)(CN1CCS(=O)(=O)CC1)C(=O)O
InChIInChI=1S/C9H17NO4S/c1-9(2,8(11)12)7-10-3-5-15(13,14)6-4-10/h3-7H2,1-2H3,(H,11,12)
InChIKeyQVRFSZLIECWBFW-UHFFFAOYSA-N
XLogP-0.17
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.30
LogP ≤ 5-0.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethylpropanoic acid (CID 62272681) is 3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethylpropanoic acid is CC(C)(CN1CCS(=O)(=O)CC1)C(=O)O.
What is the InChIKey of 3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethylpropanoic acid?
The InChIKey is QVRFSZLIECWBFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4S/c1-9(2,8(11)12)7-10-3-5-15(13,14)6-4-10/h3-7H2,1-2H3,(H,11,12).
What are the key properties of 3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethylpropanoic acid?
3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethylpropanoic acid has a molecular weight of 235.30 g/mol, XLogP of -0.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dioxo-1,4-thiazinan-4-yl)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 62272681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).