C13H9Cl2NO4 — CID 622737
ethyl 4-[(3,4-dichloro-5-oxofuran-2-ylidene)amino]benzoate (PubChem CID 622737) has the molecular formula C13H9Cl2NO4 and a molecular weight of 314.12 g/mol. Its IUPAC name is ethyl 4-[(3,4-dichloro-5-oxofuran-2-ylidene)amino]benzoate.
| Compound Name | ethyl 4-[(3,4-dichloro-5-oxofuran-2-ylidene)amino]benzoate |
|---|---|
| PubChem CID | 622737 |
| Molecular Formula | C13H9Cl2NO4 |
| Molecular Weight | 314.12 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | ethyl 4-[(3,4-dichloro-5-oxofuran-2-ylidene)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2/OC(=O)C(Cl)=C2Cl)cc1 |
| InChI | InChI=1S/C13H9Cl2NO4/c1-2-19-12(17)7-3-5-8(6-4-7)16-11-9(14)10(15)13(18)20-11/h3-6H,2H2,1H3/b16-11+ |
| InChIKey | QEOIMOLHDCDROA-LFIBNONCSA-N |
| XLogP | 3.14 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.12 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|