C15H20F3NO — CID 62276408
2-methyl-2-phenyl-3-[propan-2-yl(2,2,2-trifluoroethyl)amino]propanal (PubChem CID 62276408) has the molecular formula C15H20F3NO and a molecular weight of 287.32 g/mol. Its IUPAC name is 2-methyl-2-phenyl-3-[propan-2-yl(2,2,2-trifluoroethyl)amino]propanal.
| Compound Name | 2-methyl-2-phenyl-3-[propan-2-yl(2,2,2-trifluoroethyl)amino]propanal |
|---|---|
| PubChem CID | 62276408 |
| Molecular Formula | C15H20F3NO |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-methyl-2-phenyl-3-[propan-2-yl(2,2,2-trifluoroethyl)amino]propanal |
| SMILES | CC(C)N(CC(F)(F)F)CC(C)(C=O)c1ccccc1 |
| InChI | InChI=1S/C15H20F3NO/c1-12(2)19(10-15(16,17)18)9-14(3,11-20)13-7-5-4-6-8-13/h4-8,11-12H,9-10H2,1-3H3 |
| InChIKey | FXVNDDMZPHWKSM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|