About (6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-(5-chlorothiophen-2-yl)methanol
(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-(5-chlorothiophen-2-yl)methanol (PubChem CID 62276704) has the molecular formula C13H10Cl2O3S
and a molecular weight of 317.19 g/mol. Its IUPAC name is (6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-(5-chlorothiophen-2-yl)methanol.
Molecular Properties
| Compound Name | (6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-(5-chlorothiophen-2-yl)methanol |
| PubChem CID | 62276704 |
| Molecular Formula | C13H10Cl2O3S |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | (6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-(5-chlorothiophen-2-yl)methanol |
| SMILES | OC(c1ccc(Cl)s1)c1cc2c(cc1Cl)OCCO2 |
| InChI | InChI=1S/C13H10Cl2O3S/c14-8-6-10-9(17-3-4-18-10)5-7(8)13(16)11-1-2-12(15)19-11/h1-2,5-6,13,16H,3-4H2 |
| InChIKey | UBRXNNQPFWQPOV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-(5-chlorothiophen-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-(5-chlorothiophen-2-yl)methanol?
The IUPAC name of (6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-(5-chlorothiophen-2-yl)methanol (CID 62276704) is (6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-(5-chlorothiophen-2-yl)methanol.
What is the SMILES notation for (6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-(5-chlorothiophen-2-yl)methanol?
The canonical SMILES for (6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-(5-chlorothiophen-2-yl)methanol is OC(c1ccc(Cl)s1)c1cc2c(cc1Cl)OCCO2.
What is the InChIKey of (6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-(5-chlorothiophen-2-yl)methanol?
The InChIKey is UBRXNNQPFWQPOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2O3S/c14-8-6-10-9(17-3-4-18-10)5-7(8)13(16)11-1-2-12(15)19-11/h1-2,5-6,13,16H,3-4H2.
What are the key properties of (6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-(5-chlorothiophen-2-yl)methanol?
(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-(5-chlorothiophen-2-yl)methanol has a molecular weight of 317.19 g/mol, XLogP of 3.91, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-(5-chlorothiophen-2-yl)methanol is sourced from PubChem (CID 62276704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).