C10H16F3NO — CID 62277357
3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylpropanal (PubChem CID 62277357) has the molecular formula C10H16F3NO and a molecular weight of 223.24 g/mol. Its IUPAC name is 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylpropanal.
| Compound Name | 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 62277357 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-2,2-dimethylpropanal |
| SMILES | CC(C)(C=O)CN(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C10H16F3NO/c1-9(2,7-15)5-14(8-3-4-8)6-10(11,12)13/h7-8H,3-6H2,1-2H3 |
| InChIKey | JJDJFASUIXTJGK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|